C13H13NO3 — CID 18657670
(1R,4S)-4-benzamidocyclopent-2-ene-1-carboxylic acid (PubChem CID 18657670) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is (1R,4S)-4-benzamidocyclopent-2-ene-1-carboxylic acid.
| Compound Name | (1R,4S)-4-benzamidocyclopent-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 18657670 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | (1R,4S)-4-benzamidocyclopent-2-ene-1-carboxylic acid |
| SMILES | O=C(N[C@@H]1C=C[C@H](C(=O)O)C1)c1ccccc1 |
| InChI | InChI=1S/C13H13NO3/c15-12(9-4-2-1-3-5-9)14-11-7-6-10(8-11)13(16)17/h1-7,10-11H,8H2,(H,14,15)(H,16,17)/t10-,11+/m0/s1 |
| InChIKey | FVMBTQKZBCLKJS-WDEREUQCSA-N |
| XLogP | 1.45 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|