C11H10BrNO3S — CID 79208530
4-[(5-bromothiophene-3-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid (PubChem CID 79208530) has the molecular formula C11H10BrNO3S and a molecular weight of 316.18 g/mol. Its IUPAC name is 4-[(5-bromothiophene-3-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid.
| Compound Name | 4-[(5-bromothiophene-3-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 79208530 |
| Molecular Formula | C11H10BrNO3S |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 314.96 |
| IUPAC Name | 4-[(5-bromothiophene-3-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid |
| SMILES | O=C(NC1C=CC(C(=O)O)C1)c1csc(Br)c1 |
| InChI | InChI=1S/C11H10BrNO3S/c12-9-4-7(5-17-9)10(14)13-8-2-1-6(3-8)11(15)16/h1-2,4-6,8H,3H2,(H,13,14)(H,15,16) |
| InChIKey | ADMRNWBMBBBEGC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|