C13H10F3NO3 — CID 79209881
4-[(3,4,5-trifluorobenzoyl)amino]cyclopent-2-ene-1-carboxylic acid (PubChem CID 79209881) has the molecular formula C13H10F3NO3 and a molecular weight of 285.22 g/mol. Its IUPAC name is 4-[(3,4,5-trifluorobenzoyl)amino]cyclopent-2-ene-1-carboxylic acid.
| Compound Name | 4-[(3,4,5-trifluorobenzoyl)amino]cyclopent-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 79209881 |
| Molecular Formula | C13H10F3NO3 |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 4-[(3,4,5-trifluorobenzoyl)amino]cyclopent-2-ene-1-carboxylic acid |
| SMILES | O=C(NC1C=CC(C(=O)O)C1)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C13H10F3NO3/c14-9-4-7(5-10(15)11(9)16)12(18)17-8-2-1-6(3-8)13(19)20/h1-2,4-6,8H,3H2,(H,17,18)(H,19,20) |
| InChIKey | FVIGEXGHQSHOJZ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|