C13H11ClFNO3 — CID 82875478
4-[(3-chloro-4-fluorobenzoyl)amino]cyclopent-2-ene-1-carboxylic acid (PubChem CID 82875478) has the molecular formula C13H11ClFNO3 and a molecular weight of 283.69 g/mol. Its IUPAC name is 4-[(3-chloro-4-fluorobenzoyl)amino]cyclopent-2-ene-1-carboxylic acid.
| Compound Name | 4-[(3-chloro-4-fluorobenzoyl)amino]cyclopent-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 82875478 |
| Molecular Formula | C13H11ClFNO3 |
| Molecular Weight | 283.69 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 4-[(3-chloro-4-fluorobenzoyl)amino]cyclopent-2-ene-1-carboxylic acid |
| SMILES | O=C(NC1C=CC(C(=O)O)C1)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C13H11ClFNO3/c14-10-6-7(2-4-11(10)15)12(17)16-9-3-1-8(5-9)13(18)19/h1-4,6,8-9H,5H2,(H,16,17)(H,18,19) |
| InChIKey | YQBHBNCYSLXTRN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.69 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|