C12H10Cl2N2O3 — CID 79209097
4-[(5,6-dichloropyridine-3-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid (PubChem CID 79209097) has the molecular formula C12H10Cl2N2O3 and a molecular weight of 301.13 g/mol. Its IUPAC name is 4-[(5,6-dichloropyridine-3-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid.
| Compound Name | 4-[(5,6-dichloropyridine-3-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 79209097 |
| Molecular Formula | C12H10Cl2N2O3 |
| Molecular Weight | 301.13 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | 4-[(5,6-dichloropyridine-3-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid |
| SMILES | O=C(NC1C=CC(C(=O)O)C1)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H10Cl2N2O3/c13-9-4-7(5-15-10(9)14)11(17)16-8-2-1-6(3-8)12(18)19/h1-2,4-6,8H,3H2,(H,16,17)(H,18,19) |
| InChIKey | CTDYSYVKJGCEEP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.13 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|