C13H12F3NO3 — CID 9102312
N-[(3S,6R)-2-oxo-6-(trifluoromethyl)oxan-3-yl]benzamide (PubChem CID 9102312) has the molecular formula C13H12F3NO3 and a molecular weight of 287.24 g/mol. Its IUPAC name is N-[(3S,6R)-2-oxo-6-(trifluoromethyl)oxan-3-yl]benzamide.
| Compound Name | N-[(3S,6R)-2-oxo-6-(trifluoromethyl)oxan-3-yl]benzamide |
|---|---|
| PubChem CID | 9102312 |
| Molecular Formula | C13H12F3NO3 |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | N-[(3S,6R)-2-oxo-6-(trifluoromethyl)oxan-3-yl]benzamide |
| SMILES | O=C(N[C@H]1CC[C@H](C(F)(F)F)OC1=O)c1ccccc1 |
| InChI | InChI=1S/C13H12F3NO3/c14-13(15,16)10-7-6-9(12(19)20-10)17-11(18)8-4-2-1-3-5-8/h1-5,9-10H,6-7H2,(H,17,18)/t9-,10+/m0/s1 |
| InChIKey | AFBPJKXEUZWYTR-VHSXEESVSA-N |
| XLogP | 2.05 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |