C13H16N2O3 — CID 151585360
2-benzamidopiperidine-1-carboxylic acid (PubChem CID 151585360) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 2-benzamidopiperidine-1-carboxylic acid.
| Compound Name | 2-benzamidopiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 151585360 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 2-benzamidopiperidine-1-carboxylic acid |
| SMILES | O=C(NC1CCCCN1C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C13H16N2O3/c16-12(10-6-2-1-3-7-10)14-11-8-4-5-9-15(11)13(17)18/h1-3,6-7,11H,4-5,8-9H2,(H,14,16)(H,17,18) |
| InChIKey | QHJLNLQRPFRVNI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |