C19H22N2O2 — CID 141121427
N-(1-benzylpiperidin-2-yl)-4-hydroxybenzamide (PubChem CID 141121427) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is N-(1-benzylpiperidin-2-yl)-4-hydroxybenzamide.
| Compound Name | N-(1-benzylpiperidin-2-yl)-4-hydroxybenzamide |
|---|---|
| PubChem CID | 141121427 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | N-(1-benzylpiperidin-2-yl)-4-hydroxybenzamide |
| SMILES | O=C(NC1CCCCN1Cc1ccccc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C19H22N2O2/c22-17-11-9-16(10-12-17)19(23)20-18-8-4-5-13-21(18)14-15-6-2-1-3-7-15/h1-3,6-7,9-12,18,22H,4-5,8,13-14H2,(H,20,23) |
| InChIKey | PUPUCYICJULHCZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |