C22H19N3O2 — CID 137355564
N-[(3S)-2-oxo-5-phenyl-3,4-dihydro-1H-1,5-benzodiazepin-3-yl]benzamide (PubChem CID 137355564) has the molecular formula C22H19N3O2 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-[(3S)-2-oxo-5-phenyl-3,4-dihydro-1H-1,5-benzodiazepin-3-yl]benzamide.
| Compound Name | N-[(3S)-2-oxo-5-phenyl-3,4-dihydro-1H-1,5-benzodiazepin-3-yl]benzamide |
|---|---|
| PubChem CID | 137355564 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N-[(3S)-2-oxo-5-phenyl-3,4-dihydro-1H-1,5-benzodiazepin-3-yl]benzamide |
| SMILES | O=C(N[C@H]1CN(c2ccccc2)c2ccccc2NC1=O)c1ccccc1 |
| InChI | InChI=1S/C22H19N3O2/c26-21(16-9-3-1-4-10-16)24-19-15-25(17-11-5-2-6-12-17)20-14-8-7-13-18(20)23-22(19)27/h1-14,19H,15H2,(H,23,27)(H,24,26)/t19-/m0/s1 |
| InChIKey | SGJBYINJHAKPKC-IBGZPJMESA-N |
| XLogP | 3.58 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |