C16H12FIN2O2 — CID 97350110
3-fluoro-4-iodo-N-[(3R)-2-oxo-1-phenylazetidin-3-yl]benzamide (PubChem CID 97350110) has the molecular formula C16H12FIN2O2 and a molecular weight of 410.19 g/mol. Its IUPAC name is 3-fluoro-4-iodo-N-[(3R)-2-oxo-1-phenylazetidin-3-yl]benzamide.
| Compound Name | 3-fluoro-4-iodo-N-[(3R)-2-oxo-1-phenylazetidin-3-yl]benzamide |
|---|---|
| PubChem CID | 97350110 |
| Molecular Formula | C16H12FIN2O2 |
| Molecular Weight | 410.19 g/mol |
| Exact Mass | 409.99 |
| IUPAC Name | 3-fluoro-4-iodo-N-[(3R)-2-oxo-1-phenylazetidin-3-yl]benzamide |
| SMILES | O=C(N[C@@H]1CN(c2ccccc2)C1=O)c1ccc(I)c(F)c1 |
| InChI | InChI=1S/C16H12FIN2O2/c17-12-8-10(6-7-13(12)18)15(21)19-14-9-20(16(14)22)11-4-2-1-3-5-11/h1-8,14H,9H2,(H,19,21)/t14-/m1/s1 |
| InChIKey | GMWRQONEYRHDJW-CQSZACIVSA-N |
| XLogP | 2.58 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.19 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|