C20H18F4N2O4 — CID 10025470
3,4-bis(difluoromethoxy)-N-[(3S)-2-oxo-1-phenylpiperidin-3-yl]benzamide (PubChem CID 10025470) has the molecular formula C20H18F4N2O4 and a molecular weight of 426.37 g/mol. Its IUPAC name is 3,4-bis(difluoromethoxy)-N-[(3S)-2-oxo-1-phenylpiperidin-3-yl]benzamide.
| Compound Name | 3,4-bis(difluoromethoxy)-N-[(3S)-2-oxo-1-phenylpiperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 10025470 |
| Molecular Formula | C20H18F4N2O4 |
| Molecular Weight | 426.37 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 3,4-bis(difluoromethoxy)-N-[(3S)-2-oxo-1-phenylpiperidin-3-yl]benzamide |
| SMILES | O=C(N[C@H]1CCCN(c2ccccc2)C1=O)c1ccc(OC(F)F)c(OC(F)F)c1 |
| InChI | InChI=1S/C20H18F4N2O4/c21-19(22)29-15-9-8-12(11-16(15)30-20(23)24)17(27)25-14-7-4-10-26(18(14)28)13-5-2-1-3-6-13/h1-3,5-6,8-9,11,14,19-20H,4,7,10H2,(H,25,27)/t14-/m0/s1 |
| InChIKey | VGJTVBWGLFTRLT-AWEZNQCLSA-N |
| XLogP | 3.81 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |