C24H26F2N2O4 — CID 11744168
N-[(3S)-1-benzyl-2-oxopyrrolidin-3-yl]-3-cyclopentyloxy-4-(difluoromethoxy)benzamide (PubChem CID 11744168) has the molecular formula C24H26F2N2O4 and a molecular weight of 444.48 g/mol. Its IUPAC name is N-[(3S)-1-benzyl-2-oxopyrrolidin-3-yl]-3-cyclopentyloxy-4-(difluoromethoxy)benzamide.
| Compound Name | N-[(3S)-1-benzyl-2-oxopyrrolidin-3-yl]-3-cyclopentyloxy-4-(difluoromethoxy)benzamide |
|---|---|
| PubChem CID | 11744168 |
| Molecular Formula | C24H26F2N2O4 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | N-[(3S)-1-benzyl-2-oxopyrrolidin-3-yl]-3-cyclopentyloxy-4-(difluoromethoxy)benzamide |
| SMILES | O=C(N[C@H]1CCN(Cc2ccccc2)C1=O)c1ccc(OC(F)F)c(OC2CCCC2)c1 |
| InChI | InChI=1S/C24H26F2N2O4/c25-24(26)32-20-11-10-17(14-21(20)31-18-8-4-5-9-18)22(29)27-19-12-13-28(23(19)30)15-16-6-2-1-3-7-16/h1-3,6-7,10-11,14,18-19,24H,4-5,8-9,12-13,15H2,(H,27,29)/t19-/m0/s1 |
| InChIKey | PWARMGPXJURQSP-IBGZPJMESA-N |
| XLogP | 4.14 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |