C25H25F3N2O5 — CID 10255000
3-cyclopentyloxy-N-[(3S)-2,5-dioxo-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]-4-methoxybenzamide (PubChem CID 10255000) has the molecular formula C25H25F3N2O5 and a molecular weight of 490.48 g/mol. Its IUPAC name is 3-cyclopentyloxy-N-[(3S)-2,5-dioxo-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]-4-methoxybenzamide.
| Compound Name | 3-cyclopentyloxy-N-[(3S)-2,5-dioxo-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 10255000 |
| Molecular Formula | C25H25F3N2O5 |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 3-cyclopentyloxy-N-[(3S)-2,5-dioxo-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N[C@H]2CC(=O)N(Cc3ccc(C(F)(F)F)cc3)C2=O)cc1OC1CCCC1 |
| InChI | InChI=1S/C25H25F3N2O5/c1-34-20-11-8-16(12-21(20)35-18-4-2-3-5-18)23(32)29-19-13-22(31)30(24(19)33)14-15-6-9-17(10-7-15)25(26,27)28/h6-12,18-19H,2-5,13-14H2,1H3,(H,29,32)/t19-/m0/s1 |
| InChIKey | DGGYAMZTNVHJLU-IBGZPJMESA-N |
| XLogP | 4.09 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|