C19H22N2O7 — CID 142869381
methyl 2-[(3S)-3-[(3-cyclopentyloxy-4-hydroxybenzoyl)amino]-2,5-dioxopyrrolidin-1-yl]acetate (PubChem CID 142869381) has the molecular formula C19H22N2O7 and a molecular weight of 390.39 g/mol. Its IUPAC name is methyl 2-[(3S)-3-[(3-cyclopentyloxy-4-hydroxybenzoyl)amino]-2,5-dioxopyrrolidin-1-yl]acetate.
| Compound Name | methyl 2-[(3S)-3-[(3-cyclopentyloxy-4-hydroxybenzoyl)amino]-2,5-dioxopyrrolidin-1-yl]acetate |
|---|---|
| PubChem CID | 142869381 |
| Molecular Formula | C19H22N2O7 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | methyl 2-[(3S)-3-[(3-cyclopentyloxy-4-hydroxybenzoyl)amino]-2,5-dioxopyrrolidin-1-yl]acetate |
| SMILES | COC(=O)CN1C(=O)C[C@H](NC(=O)c2ccc(O)c(OC3CCCC3)c2)C1=O |
| InChI | InChI=1S/C19H22N2O7/c1-27-17(24)10-21-16(23)9-13(19(21)26)20-18(25)11-6-7-14(22)15(8-11)28-12-4-2-3-5-12/h6-8,12-13,22H,2-5,9-10H2,1H3,(H,20,25)/t13-/m0/s1 |
| InChIKey | MAXYXBKBRPYPSS-ZDUSSCGKSA-N |
| XLogP | 0.74 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|