About N-[1-[(4-chlorophenyl)methyl]-2-oxoazepan-3-yl]-3,4-difluorobenzamide
N-[1-[(4-chlorophenyl)methyl]-2-oxoazepan-3-yl]-3,4-difluorobenzamide (PubChem CID 53488317) has the molecular formula C20H19ClF2N2O2
and a molecular weight of 392.83 g/mol. Its IUPAC name is N-[1-[(4-chlorophenyl)methyl]-2-oxoazepan-3-yl]-3,4-difluorobenzamide.
Molecular Properties
| Compound Name | N-[1-[(4-chlorophenyl)methyl]-2-oxoazepan-3-yl]-3,4-difluorobenzamide |
| PubChem CID | 53488317 |
| Molecular Formula | C20H19ClF2N2O2 |
| Molecular Weight | 392.83 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | N-[1-[(4-chlorophenyl)methyl]-2-oxoazepan-3-yl]-3,4-difluorobenzamide |
| SMILES | O=C(NC1CCCCN(Cc2ccc(Cl)cc2)C1=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H19ClF2N2O2/c21-15-7-4-13(5-8-15)12-25-10-2-1-3-18(20(25)27)24-19(26)14-6-9-16(22)17(23)11-14/h4-9,11,18H,1-3,10,12H2,(H,24,26) |
| InChIKey | VLJUTGRMMAFMHA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.83 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[1-[(4-chlorophenyl)methyl]-2-oxoazepan-3-yl]-3,4-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[(4-chlorophenyl)methyl]-2-oxoazepan-3-yl]-3,4-difluorobenzamide?
The IUPAC name of N-[1-[(4-chlorophenyl)methyl]-2-oxoazepan-3-yl]-3,4-difluorobenzamide (CID 53488317) is N-[1-[(4-chlorophenyl)methyl]-2-oxoazepan-3-yl]-3,4-difluorobenzamide.
What is the SMILES notation for N-[1-[(4-chlorophenyl)methyl]-2-oxoazepan-3-yl]-3,4-difluorobenzamide?
The canonical SMILES for N-[1-[(4-chlorophenyl)methyl]-2-oxoazepan-3-yl]-3,4-difluorobenzamide is O=C(NC1CCCCN(Cc2ccc(Cl)cc2)C1=O)c1ccc(F)c(F)c1.
What is the InChIKey of N-[1-[(4-chlorophenyl)methyl]-2-oxoazepan-3-yl]-3,4-difluorobenzamide?
The InChIKey is VLJUTGRMMAFMHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19ClF2N2O2/c21-15-7-4-13(5-8-15)12-25-10-2-1-3-18(20(25)27)24-19(26)14-6-9-16(22)17(23)11-14/h4-9,11,18H,1-3,10,12H2,(H,24,26).
What are the key properties of N-[1-[(4-chlorophenyl)methyl]-2-oxoazepan-3-yl]-3,4-difluorobenzamide?
N-[1-[(4-chlorophenyl)methyl]-2-oxoazepan-3-yl]-3,4-difluorobenzamide has a molecular weight of 392.83 g/mol, XLogP of 3.93, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[(4-chlorophenyl)methyl]-2-oxoazepan-3-yl]-3,4-difluorobenzamide is sourced from PubChem (CID 53488317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).