C21H23FN2O3 — CID 56643350
N-[1-[(3-fluorophenyl)methyl]-2-oxoazepan-3-yl]-2-methoxybenzamide (PubChem CID 56643350) has the molecular formula C21H23FN2O3 and a molecular weight of 370.42 g/mol. Its IUPAC name is N-[1-[(3-fluorophenyl)methyl]-2-oxoazepan-3-yl]-2-methoxybenzamide.
| Compound Name | N-[1-[(3-fluorophenyl)methyl]-2-oxoazepan-3-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 56643350 |
| Molecular Formula | C21H23FN2O3 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | N-[1-[(3-fluorophenyl)methyl]-2-oxoazepan-3-yl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NC1CCCCN(Cc2cccc(F)c2)C1=O |
| InChI | InChI=1S/C21H23FN2O3/c1-27-19-11-3-2-9-17(19)20(25)23-18-10-4-5-12-24(21(18)26)14-15-7-6-8-16(22)13-15/h2-3,6-9,11,13,18H,4-5,10,12,14H2,1H3,(H,23,25) |
| InChIKey | YTGOHWKUQYYMBY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |