C16H16BrF5N2O2 — CID 56643370
2-bromo-2,2-difluoro-N-[2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]azepan-3-yl]acetamide (PubChem CID 56643370) has the molecular formula C16H16BrF5N2O2 and a molecular weight of 443.21 g/mol. Its IUPAC name is 2-bromo-2,2-difluoro-N-[2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]azepan-3-yl]acetamide.
| Compound Name | 2-bromo-2,2-difluoro-N-[2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]azepan-3-yl]acetamide |
|---|---|
| PubChem CID | 56643370 |
| Molecular Formula | C16H16BrF5N2O2 |
| Molecular Weight | 443.21 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | 2-bromo-2,2-difluoro-N-[2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]azepan-3-yl]acetamide |
| SMILES | O=C1C(NC(=O)C(F)(F)Br)CCCCN1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H16BrF5N2O2/c17-15(18,19)14(26)23-12-6-1-2-7-24(13(12)25)9-10-4-3-5-11(8-10)16(20,21)22/h3-5,8,12H,1-2,6-7,9H2,(H,23,26) |
| InChIKey | NBKHAHRSOFXZLF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.21 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|