C18H22F3N3O2 — CID 177164679
[(3R,4aS,8aR)-2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]-3,4,4a,5,6,7,8,8a-octahydroquinolin-3-yl]urea (PubChem CID 177164679) has the molecular formula C18H22F3N3O2 and a molecular weight of 369.39 g/mol. Its IUPAC name is [(3R,4aS,8aR)-2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]-3,4,4a,5,6,7,8,8a-octahydroquinolin-3-yl]urea.
| Compound Name | [(3R,4aS,8aR)-2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]-3,4,4a,5,6,7,8,8a-octahydroquinolin-3-yl]urea |
|---|---|
| PubChem CID | 177164679 |
| Molecular Formula | C18H22F3N3O2 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | [(3R,4aS,8aR)-2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]-3,4,4a,5,6,7,8,8a-octahydroquinolin-3-yl]urea |
| SMILES | NC(=O)N[C@@H]1C[C@@H]2CCCC[C@H]2N(Cc2cccc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C18H22F3N3O2/c19-18(20,21)13-6-3-4-11(8-13)10-24-15-7-2-1-5-12(15)9-14(16(24)25)23-17(22)26/h3-4,6,8,12,14-15H,1-2,5,7,9-10H2,(H3,22,23,26)/t12-,14+,15+/m0/s1 |
| InChIKey | CBDGHMHROOMBJR-NWANDNLSSA-N |
| XLogP | 3.03 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |