C29H26F3N3O2 — CID 56643368
N-[2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]azepan-3-yl]benzo[b][1]benzazepine-11-carboxamide (PubChem CID 56643368) has the molecular formula C29H26F3N3O2 and a molecular weight of 505.54 g/mol. Its IUPAC name is N-[2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]azepan-3-yl]benzo[b][1]benzazepine-11-carboxamide.
| Compound Name | N-[2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]azepan-3-yl]benzo[b][1]benzazepine-11-carboxamide |
|---|---|
| PubChem CID | 56643368 |
| Molecular Formula | C29H26F3N3O2 |
| Molecular Weight | 505.54 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | N-[2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]azepan-3-yl]benzo[b][1]benzazepine-11-carboxamide |
| SMILES | O=C1C(NC(=O)N2c3ccccc3C=Cc3ccccc32)CCCCN1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H26F3N3O2/c30-29(31,32)23-11-7-8-20(18-23)19-34-17-6-5-12-24(27(34)36)33-28(37)35-25-13-3-1-9-21(25)15-16-22-10-2-4-14-26(22)35/h1-4,7-11,13-16,18,24H,5-6,12,17,19H2,(H,33,37) |
| InChIKey | YVSHVNDOZWAZPN-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.54 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|