C19H19F2N3O3 — CID 119806136
3-amino-N-[1-[4-(difluoromethoxy)phenyl]-2-oxopiperidin-3-yl]benzamide (PubChem CID 119806136) has the molecular formula C19H19F2N3O3 and a molecular weight of 375.38 g/mol. Its IUPAC name is 3-amino-N-[1-[4-(difluoromethoxy)phenyl]-2-oxopiperidin-3-yl]benzamide.
| Compound Name | 3-amino-N-[1-[4-(difluoromethoxy)phenyl]-2-oxopiperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 119806136 |
| Molecular Formula | C19H19F2N3O3 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 3-amino-N-[1-[4-(difluoromethoxy)phenyl]-2-oxopiperidin-3-yl]benzamide |
| SMILES | Nc1cccc(C(=O)NC2CCCN(c3ccc(OC(F)F)cc3)C2=O)c1 |
| InChI | InChI=1S/C19H19F2N3O3/c20-19(21)27-15-8-6-14(7-9-15)24-10-2-5-16(18(24)26)23-17(25)12-3-1-4-13(22)11-12/h1,3-4,6-9,11,16,19H,2,5,10,22H2,(H,23,25) |
| InChIKey | KGNCSYMTQFMBAD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|