C17H24ClF2N3O4 — CID 119806149
N-[1-[4-(difluoromethoxy)phenyl]-2-oxopiperidin-3-yl]-2-(2-methoxyethylamino)acetamide;hydrochloride (PubChem CID 119806149) has the molecular formula C17H24ClF2N3O4 and a molecular weight of 407.85 g/mol. Its IUPAC name is N-[1-[4-(difluoromethoxy)phenyl]-2-oxopiperidin-3-yl]-2-(2-methoxyethylamino)acetamide;hydrochloride.
| Compound Name | N-[1-[4-(difluoromethoxy)phenyl]-2-oxopiperidin-3-yl]-2-(2-methoxyethylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119806149 |
| Molecular Formula | C17H24ClF2N3O4 |
| Molecular Weight | 407.85 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | N-[1-[4-(difluoromethoxy)phenyl]-2-oxopiperidin-3-yl]-2-(2-methoxyethylamino)acetamide;hydrochloride |
| SMILES | COCCNCC(=O)NC1CCCN(c2ccc(OC(F)F)cc2)C1=O.Cl |
| InChI | InChI=1S/C17H23F2N3O4.ClH/c1-25-10-8-20-11-15(23)21-14-3-2-9-22(16(14)24)12-4-6-13(7-5-12)26-17(18)19;/h4-7,14,17,20H,2-3,8-11H2,1H3,(H,21,23);1H |
| InChIKey | MDNFUZAQWJXPJU-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.85 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|