C20H21F2N3O3 — CID 119806116
2-(4-aminophenyl)-N-[1-[4-(difluoromethoxy)phenyl]-2-oxopiperidin-3-yl]acetamide (PubChem CID 119806116) has the molecular formula C20H21F2N3O3 and a molecular weight of 389.40 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-[1-[4-(difluoromethoxy)phenyl]-2-oxopiperidin-3-yl]acetamide.
| Compound Name | 2-(4-aminophenyl)-N-[1-[4-(difluoromethoxy)phenyl]-2-oxopiperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 119806116 |
| Molecular Formula | C20H21F2N3O3 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 2-(4-aminophenyl)-N-[1-[4-(difluoromethoxy)phenyl]-2-oxopiperidin-3-yl]acetamide |
| SMILES | Nc1ccc(CC(=O)NC2CCCN(c3ccc(OC(F)F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C20H21F2N3O3/c21-20(22)28-16-9-7-15(8-10-16)25-11-1-2-17(19(25)27)24-18(26)12-13-3-5-14(23)6-4-13/h3-10,17,20H,1-2,11-12,23H2,(H,24,26) |
| InChIKey | ARSPPHVUPJDXFR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|