C19H25F2N3O4 — CID 120935390
4-(aminomethyl)-N-[1-[4-(difluoromethoxy)phenyl]-2-oxopiperidin-3-yl]oxane-4-carboxamide (PubChem CID 120935390) has the molecular formula C19H25F2N3O4 and a molecular weight of 397.42 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[1-[4-(difluoromethoxy)phenyl]-2-oxopiperidin-3-yl]oxane-4-carboxamide.
| Compound Name | 4-(aminomethyl)-N-[1-[4-(difluoromethoxy)phenyl]-2-oxopiperidin-3-yl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 120935390 |
| Molecular Formula | C19H25F2N3O4 |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 4-(aminomethyl)-N-[1-[4-(difluoromethoxy)phenyl]-2-oxopiperidin-3-yl]oxane-4-carboxamide |
| SMILES | NCC1(C(=O)NC2CCCN(c3ccc(OC(F)F)cc3)C2=O)CCOCC1 |
| InChI | InChI=1S/C19H25F2N3O4/c20-18(21)28-14-5-3-13(4-6-14)24-9-1-2-15(16(24)25)23-17(26)19(12-22)7-10-27-11-8-19/h3-6,15,18H,1-2,7-12,22H2,(H,23,26) |
| InChIKey | GIQUZMJQIXXZHI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |