C18H25F2N3O3 — CID 119806156
(2S)-2-amino-N-[1-[4-(difluoromethoxy)phenyl]-2-oxopiperidin-3-yl]-4-methylpentanamide (PubChem CID 119806156) has the molecular formula C18H25F2N3O3 and a molecular weight of 369.41 g/mol. Its IUPAC name is (2S)-2-amino-N-[1-[4-(difluoromethoxy)phenyl]-2-oxopiperidin-3-yl]-4-methylpentanamide.
| Compound Name | (2S)-2-amino-N-[1-[4-(difluoromethoxy)phenyl]-2-oxopiperidin-3-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 119806156 |
| Molecular Formula | C18H25F2N3O3 |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | (2S)-2-amino-N-[1-[4-(difluoromethoxy)phenyl]-2-oxopiperidin-3-yl]-4-methylpentanamide |
| SMILES | CC(C)C[C@H](N)C(=O)NC1CCCN(c2ccc(OC(F)F)cc2)C1=O |
| InChI | InChI=1S/C18H25F2N3O3/c1-11(2)10-14(21)16(24)22-15-4-3-9-23(17(15)25)12-5-7-13(8-6-12)26-18(19)20/h5-8,11,14-15,18H,3-4,9-10,21H2,1-2H3,(H,22,24)/t14-,15?/m0/s1 |
| InChIKey | AIZBWBGDUDIQTR-MLCCFXAWSA-N |
| XLogP | 2.27 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |