C16H20F3N3O4 — CID 119787510
2-(2-methoxyethylamino)-N-[2-oxo-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]acetamide (PubChem CID 119787510) has the molecular formula C16H20F3N3O4 and a molecular weight of 375.35 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-N-[2-oxo-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]acetamide.
| Compound Name | 2-(2-methoxyethylamino)-N-[2-oxo-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 119787510 |
| Molecular Formula | C16H20F3N3O4 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 2-(2-methoxyethylamino)-N-[2-oxo-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]acetamide |
| SMILES | COCCNCC(=O)NC1CCN(c2cccc(OC(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C16H20F3N3O4/c1-25-8-6-20-10-14(23)21-13-5-7-22(15(13)24)11-3-2-4-12(9-11)26-16(17,18)19/h2-4,9,13,20H,5-8,10H2,1H3,(H,21,23) |
| InChIKey | LFWFCFRQBUCRKX-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|