C17H22F3N3O3 — CID 119787502
2-amino-3-methyl-N-[2-oxo-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]pentanamide (PubChem CID 119787502) has the molecular formula C17H22F3N3O3 and a molecular weight of 373.38 g/mol. Its IUPAC name is 2-amino-3-methyl-N-[2-oxo-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]pentanamide.
| Compound Name | 2-amino-3-methyl-N-[2-oxo-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]pentanamide |
|---|---|
| PubChem CID | 119787502 |
| Molecular Formula | C17H22F3N3O3 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 2-amino-3-methyl-N-[2-oxo-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]pentanamide |
| SMILES | CCC(C)C(N)C(=O)NC1CCN(c2cccc(OC(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C17H22F3N3O3/c1-3-10(2)14(21)15(24)22-13-7-8-23(16(13)25)11-5-4-6-12(9-11)26-17(18,19)20/h4-6,9-10,13-14H,3,7-8,21H2,1-2H3,(H,22,24) |
| InChIKey | MCJPSHAEFHPBKB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |