C21H18F3N3O3 — CID 102557214
6-methyl-N-[2-oxo-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]-1H-indole-2-carboxamide (PubChem CID 102557214) has the molecular formula C21H18F3N3O3 and a molecular weight of 417.39 g/mol. Its IUPAC name is 6-methyl-N-[2-oxo-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]-1H-indole-2-carboxamide.
| Compound Name | 6-methyl-N-[2-oxo-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 102557214 |
| Molecular Formula | C21H18F3N3O3 |
| Molecular Weight | 417.39 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 6-methyl-N-[2-oxo-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]-1H-indole-2-carboxamide |
| SMILES | Cc1ccc2cc(C(=O)NC3CCN(c4cccc(OC(F)(F)F)c4)C3=O)[nH]c2c1 |
| InChI | InChI=1S/C21H18F3N3O3/c1-12-5-6-13-10-18(25-17(13)9-12)19(28)26-16-7-8-27(20(16)29)14-3-2-4-15(11-14)30-21(22,23)24/h2-6,9-11,16,25H,7-8H2,1H3,(H,26,28) |
| InChIKey | KVEWAARIZGBYOE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |