C18H19N3O4 — CID 138053753
4-methoxy-6-oxo-N-(2-oxo-1-phenylpiperidin-3-yl)-1H-pyridine-3-carboxamide (PubChem CID 138053753) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 4-methoxy-6-oxo-N-(2-oxo-1-phenylpiperidin-3-yl)-1H-pyridine-3-carboxamide.
| Compound Name | 4-methoxy-6-oxo-N-(2-oxo-1-phenylpiperidin-3-yl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 138053753 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 4-methoxy-6-oxo-N-(2-oxo-1-phenylpiperidin-3-yl)-1H-pyridine-3-carboxamide |
| SMILES | COc1cc(=O)[nH]cc1C(=O)NC1CCCN(c2ccccc2)C1=O |
| InChI | InChI=1S/C18H19N3O4/c1-25-15-10-16(22)19-11-13(15)17(23)20-14-8-5-9-21(18(14)24)12-6-3-2-4-7-12/h2-4,6-7,10-11,14H,5,8-9H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | ATGPMMNFGIQJAL-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |