C18H23NO6 — CID 10569790
butyl (2S)-3-[(2S,4S)-4-benzamido-5-oxooxolan-2-yl]-2-hydroxypropanoate (PubChem CID 10569790) has the molecular formula C18H23NO6 and a molecular weight of 349.38 g/mol. Its IUPAC name is butyl (2S)-3-[(2S,4S)-4-benzamido-5-oxooxolan-2-yl]-2-hydroxypropanoate.
| Compound Name | butyl (2S)-3-[(2S,4S)-4-benzamido-5-oxooxolan-2-yl]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 10569790 |
| Molecular Formula | C18H23NO6 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | butyl (2S)-3-[(2S,4S)-4-benzamido-5-oxooxolan-2-yl]-2-hydroxypropanoate |
| SMILES | CCCCOC(=O)[C@@H](O)C[C@@H]1C[C@H](NC(=O)c2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C18H23NO6/c1-2-3-9-24-18(23)15(20)11-13-10-14(17(22)25-13)19-16(21)12-7-5-4-6-8-12/h4-8,13-15,20H,2-3,9-11H2,1H3,(H,19,21)/t13-,14-,15-/m0/s1 |
| InChIKey | ZKOOAGNFZPRPDU-KKUMJFAQSA-N |
| XLogP | 1.19 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|