C18H23NO4 — CID 87959472
3-oxo-N-[(3S)-2-oxo-5-phenyloxolan-3-yl]octanamide (PubChem CID 87959472) has the molecular formula C18H23NO4 and a molecular weight of 317.38 g/mol. Its IUPAC name is 3-oxo-N-[(3S)-2-oxo-5-phenyloxolan-3-yl]octanamide.
| Compound Name | 3-oxo-N-[(3S)-2-oxo-5-phenyloxolan-3-yl]octanamide |
|---|---|
| PubChem CID | 87959472 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 3-oxo-N-[(3S)-2-oxo-5-phenyloxolan-3-yl]octanamide |
| SMILES | CCCCCC(=O)CC(=O)N[C@H]1CC(c2ccccc2)OC1=O |
| InChI | InChI=1S/C18H23NO4/c1-2-3-5-10-14(20)11-17(21)19-15-12-16(23-18(15)22)13-8-6-4-7-9-13/h4,6-9,15-16H,2-3,5,10-12H2,1H3,(H,19,21)/t15-,16?/m0/s1 |
| InChIKey | PZEJBINBFGQVPY-VYRBHSGPSA-N |
| XLogP | 2.70 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|