About 3-pentanoyl-5-phenyl-1,3-oxazolidin-2-one
3-pentanoyl-5-phenyl-1,3-oxazolidin-2-one (PubChem CID 150213764) has the molecular formula C14H17NO3
and a molecular weight of 247.29 g/mol. Its IUPAC name is 3-pentanoyl-5-phenyl-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-pentanoyl-5-phenyl-1,3-oxazolidin-2-one |
| PubChem CID | 150213764 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 3-pentanoyl-5-phenyl-1,3-oxazolidin-2-one |
| SMILES | CCCCC(=O)N1CC(c2ccccc2)OC1=O |
| InChI | InChI=1S/C14H17NO3/c1-2-3-9-13(16)15-10-12(18-14(15)17)11-7-5-4-6-8-11/h4-8,12H,2-3,9-10H2,1H3 |
| InChIKey | FSAOVDWNIBXXMU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-pentanoyl-5-phenyl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pentanoyl-5-phenyl-1,3-oxazolidin-2-one?
The IUPAC name of 3-pentanoyl-5-phenyl-1,3-oxazolidin-2-one (CID 150213764) is 3-pentanoyl-5-phenyl-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-pentanoyl-5-phenyl-1,3-oxazolidin-2-one?
The canonical SMILES for 3-pentanoyl-5-phenyl-1,3-oxazolidin-2-one is CCCCC(=O)N1CC(c2ccccc2)OC1=O.
What is the InChIKey of 3-pentanoyl-5-phenyl-1,3-oxazolidin-2-one?
The InChIKey is FSAOVDWNIBXXMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO3/c1-2-3-9-13(16)15-10-12(18-14(15)17)11-7-5-4-6-8-11/h4-8,12H,2-3,9-10H2,1H3.
What are the key properties of 3-pentanoyl-5-phenyl-1,3-oxazolidin-2-one?
3-pentanoyl-5-phenyl-1,3-oxazolidin-2-one has a molecular weight of 247.29 g/mol, XLogP of 2.90, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pentanoyl-5-phenyl-1,3-oxazolidin-2-one is sourced from PubChem (CID 150213764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).