C10H12O4Si — CID 157111906
2-phenyl-1,3-dioxane-4,6-dione;silane (PubChem CID 157111906) has the molecular formula C10H12O4Si and a molecular weight of 224.29 g/mol. Its IUPAC name is 2-phenyl-1,3-dioxane-4,6-dione;silane.
| Compound Name | 2-phenyl-1,3-dioxane-4,6-dione;silane |
|---|---|
| PubChem CID | 157111906 |
| Molecular Formula | C10H12O4Si |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 2-phenyl-1,3-dioxane-4,6-dione;silane |
| SMILES | O=C1CC(=O)OC(c2ccccc2)O1.[SiH4] |
| InChI | InChI=1S/C10H8O4.H4Si/c11-8-6-9(12)14-10(13-8)7-4-2-1-3-5-7;/h1-5,10H,6H2;1H4 |
| InChIKey | AGYKPQAHGIRJRK-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|