C10H12ClNO2 — CID 67643297
(4S,5R)-4-amino-5-phenyloxolan-2-one;hydrochloride (PubChem CID 67643297) has the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. Its IUPAC name is (4S,5R)-4-amino-5-phenyloxolan-2-one;hydrochloride.
| Compound Name | (4S,5R)-4-amino-5-phenyloxolan-2-one;hydrochloride |
|---|---|
| PubChem CID | 67643297 |
| Molecular Formula | C10H12ClNO2 |
| Molecular Weight | 213.66 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | (4S,5R)-4-amino-5-phenyloxolan-2-one;hydrochloride |
| SMILES | Cl.N[C@H]1CC(=O)O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C10H11NO2.ClH/c11-8-6-9(12)13-10(8)7-4-2-1-3-5-7;/h1-5,8,10H,6,11H2;1H/t8-,10+;/m0./s1 |
| InChIKey | XIUBITMKELHASL-KXNXZCPBSA-N |
| XLogP | 1.42 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.66 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |