C13H15NO3 — CID 22216391
(2R,3R)-3,4-dimethyl-2-phenyl-1,4-oxazepane-5,7-dione (PubChem CID 22216391) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is (2R,3R)-3,4-dimethyl-2-phenyl-1,4-oxazepane-5,7-dione.
| Compound Name | (2R,3R)-3,4-dimethyl-2-phenyl-1,4-oxazepane-5,7-dione |
|---|---|
| PubChem CID | 22216391 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | (2R,3R)-3,4-dimethyl-2-phenyl-1,4-oxazepane-5,7-dione |
| SMILES | C[C@@H]1[C@@H](c2ccccc2)OC(=O)CC(=O)N1C |
| InChI | InChI=1S/C13H15NO3/c1-9-13(10-6-4-3-5-7-10)17-12(16)8-11(15)14(9)2/h3-7,9,13H,8H2,1-2H3/t9-,13+/m1/s1 |
| InChIKey | VWGLSJADRJXISE-RNCFNFMXSA-N |
| XLogP | 1.52 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|