C17H17NO2 — CID 54194620
(5R,6S)-4-methyl-5,6-diphenylmorpholin-2-one (PubChem CID 54194620) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is (5R,6S)-4-methyl-5,6-diphenylmorpholin-2-one.
| Compound Name | (5R,6S)-4-methyl-5,6-diphenylmorpholin-2-one |
|---|---|
| PubChem CID | 54194620 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | (5R,6S)-4-methyl-5,6-diphenylmorpholin-2-one |
| SMILES | CN1CC(=O)O[C@@H](c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H17NO2/c1-18-12-15(19)20-17(14-10-6-3-7-11-14)16(18)13-8-4-2-5-9-13/h2-11,16-17H,12H2,1H3/t16-,17+/m1/s1 |
| InChIKey | PKXSIWGTXMUTOP-SJORKVTESA-N |
| XLogP | 2.96 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |