C19H25NO3 — CID 140637251
(2R,3S,6R,8Z)-3,4,6-trimethyl-2-phenyl-1-oxa-4-azacyclododec-8-ene-5,12-dione (PubChem CID 140637251) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is (2R,3S,6R,8Z)-3,4,6-trimethyl-2-phenyl-1-oxa-4-azacyclododec-8-ene-5,12-dione.
| Compound Name | (2R,3S,6R,8Z)-3,4,6-trimethyl-2-phenyl-1-oxa-4-azacyclododec-8-ene-5,12-dione |
|---|---|
| PubChem CID | 140637251 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | (2R,3S,6R,8Z)-3,4,6-trimethyl-2-phenyl-1-oxa-4-azacyclododec-8-ene-5,12-dione |
| SMILES | C[C@@H]1C/C=C\CCC(=O)O[C@H](c2ccccc2)[C@H](C)N(C)C1=O |
| InChI | InChI=1S/C19H25NO3/c1-14-10-6-4-9-13-17(21)23-18(15(2)20(3)19(14)22)16-11-7-5-8-12-16/h4-8,11-12,14-15,18H,9-10,13H2,1-3H3/b6-4-/t14-,15+,18+/m1/s1 |
| InChIKey | PRWDHNKAKZMXNF-DRUPWRBJSA-N |
| XLogP | 3.49 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|