C23H32N2O5 — CID 86714874
tert-butyl N-[(2R,3R,6R,8E)-3,4-dimethyl-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-6-yl]carbamate (PubChem CID 86714874) has the molecular formula C23H32N2O5 and a molecular weight of 416.52 g/mol. Its IUPAC name is tert-butyl N-[(2R,3R,6R,8E)-3,4-dimethyl-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-6-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3R,6R,8E)-3,4-dimethyl-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-6-yl]carbamate |
|---|---|
| PubChem CID | 86714874 |
| Molecular Formula | C23H32N2O5 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | tert-butyl N-[(2R,3R,6R,8E)-3,4-dimethyl-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-6-yl]carbamate |
| SMILES | C[C@@H]1[C@@H](c2ccccc2)OC(=O)CC/C=C/C[C@@H](NC(=O)OC(C)(C)C)C(=O)N1C |
| InChI | InChI=1S/C23H32N2O5/c1-16-20(17-12-8-6-9-13-17)29-19(26)15-11-7-10-14-18(21(27)25(16)5)24-22(28)30-23(2,3)4/h6-10,12-13,16,18,20H,11,14-15H2,1-5H3,(H,24,28)/b10-7+/t16-,18-,20+/m1/s1 |
| InChIKey | HVJMLFHKWHNPBY-MKGRPJKYSA-N |
| XLogP | 3.75 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|