C21H31NO3 — CID 163974164
tert-butyl N-[(1R,7S,8S)-7-methyl-2-oxo-8-phenylcyclononyl]carbamate (PubChem CID 163974164) has the molecular formula C21H31NO3 and a molecular weight of 345.48 g/mol. Its IUPAC name is tert-butyl N-[(1R,7S,8S)-7-methyl-2-oxo-8-phenylcyclononyl]carbamate.
| Compound Name | tert-butyl N-[(1R,7S,8S)-7-methyl-2-oxo-8-phenylcyclononyl]carbamate |
|---|---|
| PubChem CID | 163974164 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | tert-butyl N-[(1R,7S,8S)-7-methyl-2-oxo-8-phenylcyclononyl]carbamate |
| SMILES | C[C@H]1CCCCC(=O)[C@H](NC(=O)OC(C)(C)C)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C21H31NO3/c1-15-10-8-9-13-19(23)18(22-20(24)25-21(2,3)4)14-17(15)16-11-6-5-7-12-16/h5-7,11-12,15,17-18H,8-10,13-14H2,1-4H3,(H,22,24)/t15-,17-,18+/m0/s1 |
| InChIKey | SSPNBVRHGSCCPJ-RYQLBKOJSA-N |
| XLogP | 4.83 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |