C10H10O3 — CID 18730132
2-methyl-5-phenyl-1,3-dioxolan-4-one (PubChem CID 18730132) has the molecular formula C10H10O3 and a molecular weight of 178.19 g/mol. Its IUPAC name is 2-methyl-5-phenyl-1,3-dioxolan-4-one.
| Compound Name | 2-methyl-5-phenyl-1,3-dioxolan-4-one |
|---|---|
| PubChem CID | 18730132 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 2-methyl-5-phenyl-1,3-dioxolan-4-one |
| SMILES | CC1OC(=O)C(c2ccccc2)O1 |
| InChI | InChI=1S/C10H10O3/c1-7-12-9(10(11)13-7)8-5-3-2-4-6-8/h2-7,9H,1H3 |
| InChIKey | HTWMKNKWFMQNDQ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |