C10H10O2S — CID 12581977
2-methyl-4-phenyl-1,3-oxathiolan-5-one (PubChem CID 12581977) has the molecular formula C10H10O2S and a molecular weight of 194.25 g/mol. Its IUPAC name is 2-methyl-4-phenyl-1,3-oxathiolan-5-one.
| Compound Name | 2-methyl-4-phenyl-1,3-oxathiolan-5-one |
|---|---|
| PubChem CID | 12581977 |
| Molecular Formula | C10H10O2S |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 2-methyl-4-phenyl-1,3-oxathiolan-5-one |
| SMILES | CC1OC(=O)C(c2ccccc2)S1 |
| InChI | InChI=1S/C10H10O2S/c1-7-12-10(11)9(13-7)8-5-3-2-4-6-8/h2-7,9H,1H3 |
| InChIKey | LLJRDHUUYNQKEP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |