About 6-tert-butyl-3-phenyl-1,2,4-trioxan-5-one
6-tert-butyl-3-phenyl-1,2,4-trioxan-5-one (PubChem CID 15141436) has the molecular formula C13H16O4
and a molecular weight of 236.27 g/mol. Its IUPAC name is 6-tert-butyl-3-phenyl-1,2,4-trioxan-5-one.
Molecular Properties
| Compound Name | 6-tert-butyl-3-phenyl-1,2,4-trioxan-5-one |
| PubChem CID | 15141436 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 6-tert-butyl-3-phenyl-1,2,4-trioxan-5-one |
| SMILES | CC(C)(C)C1OOC(c2ccccc2)OC1=O |
| InChI | InChI=1S/C13H16O4/c1-13(2,3)10-11(14)15-12(17-16-10)9-7-5-4-6-8-9/h4-8,10,12H,1-3H3 |
| InChIKey | LXEUXSMIFVIVNL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 6-tert-butyl-3-phenyl-1,2,4-trioxan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-3-phenyl-1,2,4-trioxan-5-one?
The IUPAC name of 6-tert-butyl-3-phenyl-1,2,4-trioxan-5-one (CID 15141436) is 6-tert-butyl-3-phenyl-1,2,4-trioxan-5-one.
What is the SMILES notation for 6-tert-butyl-3-phenyl-1,2,4-trioxan-5-one?
The canonical SMILES for 6-tert-butyl-3-phenyl-1,2,4-trioxan-5-one is CC(C)(C)C1OOC(c2ccccc2)OC1=O.
What is the InChIKey of 6-tert-butyl-3-phenyl-1,2,4-trioxan-5-one?
The InChIKey is LXEUXSMIFVIVNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O4/c1-13(2,3)10-11(14)15-12(17-16-10)9-7-5-4-6-8-9/h4-8,10,12H,1-3H3.
What are the key properties of 6-tert-butyl-3-phenyl-1,2,4-trioxan-5-one?
6-tert-butyl-3-phenyl-1,2,4-trioxan-5-one has a molecular weight of 236.27 g/mol, XLogP of 2.60, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-3-phenyl-1,2,4-trioxan-5-one is sourced from PubChem (CID 15141436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).