C18H20O — CID 13213881
(1S,3R)-1-tert-butyl-3-phenyl-1,3-dihydro-2-benzofuran (PubChem CID 13213881) has the molecular formula C18H20O and a molecular weight of 252.36 g/mol. Its IUPAC name is (1S,3R)-1-tert-butyl-3-phenyl-1,3-dihydro-2-benzofuran.
| Compound Name | (1S,3R)-1-tert-butyl-3-phenyl-1,3-dihydro-2-benzofuran |
|---|---|
| PubChem CID | 13213881 |
| Molecular Formula | C18H20O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | (1S,3R)-1-tert-butyl-3-phenyl-1,3-dihydro-2-benzofuran |
| SMILES | CC(C)(C)[C@@H]1O[C@H](c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C18H20O/c1-18(2,3)17-15-12-8-7-11-14(15)16(19-17)13-9-5-4-6-10-13/h4-12,16-17H,1-3H3/t16-,17-/m1/s1 |
| InChIKey | ZUZYOTPWTFDCSW-IAGOWNOFSA-N |
| XLogP | 4.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |