C15H16ClNO — CID 153409594
1-phenyl-3,4-dihydro-1H-isochromen-4-amine;hydrochloride (PubChem CID 153409594) has the molecular formula C15H16ClNO and a molecular weight of 261.75 g/mol. Its IUPAC name is 1-phenyl-3,4-dihydro-1H-isochromen-4-amine;hydrochloride.
| Compound Name | 1-phenyl-3,4-dihydro-1H-isochromen-4-amine;hydrochloride |
|---|---|
| PubChem CID | 153409594 |
| Molecular Formula | C15H16ClNO |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 1-phenyl-3,4-dihydro-1H-isochromen-4-amine;hydrochloride |
| SMILES | Cl.NC1COC(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C15H15NO.ClH/c16-14-10-17-15(11-6-2-1-3-7-11)13-9-5-4-8-12(13)14;/h1-9,14-15H,10,16H2;1H |
| InChIKey | TYKMOGPNJPAZCN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |