C14H13NO — CID 70600489
4-(1,3-dihydro-2-benzofuran-1-yl)aniline (PubChem CID 70600489) has the molecular formula C14H13NO and a molecular weight of 211.26 g/mol. Its IUPAC name is 4-(1,3-dihydro-2-benzofuran-1-yl)aniline.
| Compound Name | 4-(1,3-dihydro-2-benzofuran-1-yl)aniline |
|---|---|
| PubChem CID | 70600489 |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 4-(1,3-dihydro-2-benzofuran-1-yl)aniline |
| SMILES | Nc1ccc(C2OCc3ccccc32)cc1 |
| InChI | InChI=1S/C14H13NO/c15-12-7-5-10(6-8-12)14-13-4-2-1-3-11(13)9-16-14/h1-8,14H,9,15H2 |
| InChIKey | WHOGEYUKJFHOQM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|