C15H15NO — CID 12943544
4-(3,4-dihydro-1H-isochromen-1-yl)aniline (PubChem CID 12943544) has the molecular formula C15H15NO and a molecular weight of 225.29 g/mol. Its IUPAC name is 4-(3,4-dihydro-1H-isochromen-1-yl)aniline.
| Compound Name | 4-(3,4-dihydro-1H-isochromen-1-yl)aniline |
|---|---|
| PubChem CID | 12943544 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 4-(3,4-dihydro-1H-isochromen-1-yl)aniline |
| SMILES | Nc1ccc(C2OCCc3ccccc32)cc1 |
| InChI | InChI=1S/C15H15NO/c16-13-7-5-12(6-8-13)15-14-4-2-1-3-11(14)9-10-17-15/h1-8,15H,9-10,16H2 |
| InChIKey | MULCWBNXWABNJA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|