About 1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran
1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran (PubChem CID 14230259) has the molecular formula C14H11FO
and a molecular weight of 214.24 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran.
Molecular Properties
| Compound Name | 1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran |
| PubChem CID | 14230259 |
| Molecular Formula | C14H11FO |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran |
| SMILES | Fc1ccc(C2OCc3ccccc32)cc1 |
| InChI | InChI=1S/C14H11FO/c15-12-7-5-10(6-8-12)14-13-4-2-1-3-11(13)9-16-14/h1-8,14H,9H2 |
| InChIKey | UFBBMJWPPBNTGA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran?
The IUPAC name of 1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran (CID 14230259) is 1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran.
What is the SMILES notation for 1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran?
The canonical SMILES for 1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran is Fc1ccc(C2OCc3ccccc32)cc1.
What is the InChIKey of 1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran?
The InChIKey is UFBBMJWPPBNTGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11FO/c15-12-7-5-10(6-8-12)14-13-4-2-1-3-11(13)9-16-14/h1-8,14H,9H2.
What are the key properties of 1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran?
1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran has a molecular weight of 214.24 g/mol, XLogP of 3.45, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran is sourced from PubChem (CID 14230259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).