C18H14O — CID 42600516
1-naphthalen-2-yl-1,3-dihydro-2-benzofuran (PubChem CID 42600516) has the molecular formula C18H14O and a molecular weight of 246.31 g/mol. Its IUPAC name is 1-naphthalen-2-yl-1,3-dihydro-2-benzofuran.
| Compound Name | 1-naphthalen-2-yl-1,3-dihydro-2-benzofuran |
|---|---|
| PubChem CID | 42600516 |
| Molecular Formula | C18H14O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 1-naphthalen-2-yl-1,3-dihydro-2-benzofuran |
| SMILES | c1ccc2c(c1)COC2c1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H14O/c1-2-6-14-11-15(10-9-13(14)5-1)18-17-8-4-3-7-16(17)12-19-18/h1-11,18H,12H2 |
| InChIKey | OLRXPWLRTNYZHL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |