C9H9IO — CID 138756847
1-(iodomethyl)-1,3-dihydro-2-benzofuran (PubChem CID 138756847) has the molecular formula C9H9IO and a molecular weight of 260.07 g/mol. Its IUPAC name is 1-(iodomethyl)-1,3-dihydro-2-benzofuran.
| Compound Name | 1-(iodomethyl)-1,3-dihydro-2-benzofuran |
|---|---|
| PubChem CID | 138756847 |
| Molecular Formula | C9H9IO |
| Molecular Weight | 260.07 g/mol |
| Exact Mass | 259.97 |
| IUPAC Name | 1-(iodomethyl)-1,3-dihydro-2-benzofuran |
| SMILES | ICC1OCc2ccccc21 |
| InChI | InChI=1S/C9H9IO/c10-5-9-8-4-2-1-3-7(8)6-11-9/h1-4,9H,5-6H2 |
| InChIKey | JBGKCFUHFLCMGL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.07 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|