C11H14O2 — CID 57246882
3-(1,3-dihydro-2-benzofuran-1-yl)propan-1-ol (PubChem CID 57246882) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 3-(1,3-dihydro-2-benzofuran-1-yl)propan-1-ol.
| Compound Name | 3-(1,3-dihydro-2-benzofuran-1-yl)propan-1-ol |
|---|---|
| PubChem CID | 57246882 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 3-(1,3-dihydro-2-benzofuran-1-yl)propan-1-ol |
| SMILES | OCCCC1OCc2ccccc21 |
| InChI | InChI=1S/C11H14O2/c12-7-3-6-11-10-5-2-1-4-9(10)8-13-11/h1-2,4-5,11-12H,3,6-8H2 |
| InChIKey | CRXIZXGNBHBOKZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |