C9H9NO2 — CID 90959977
1-(nitrosomethyl)-1,3-dihydro-2-benzofuran (PubChem CID 90959977) has the molecular formula C9H9NO2 and a molecular weight of 163.18 g/mol. Its IUPAC name is 1-(nitrosomethyl)-1,3-dihydro-2-benzofuran.
| Compound Name | 1-(nitrosomethyl)-1,3-dihydro-2-benzofuran |
|---|---|
| PubChem CID | 90959977 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 1-(nitrosomethyl)-1,3-dihydro-2-benzofuran |
| SMILES | O=NCC1OCc2ccccc21 |
| InChI | InChI=1S/C9H9NO2/c11-10-5-9-8-4-2-1-3-7(8)6-12-9/h1-4,9H,5-6H2 |
| InChIKey | GXVRQUJHRNVHEM-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |